Products 29176-91-8
CAS 29176-91-8 is the registry number for Ethyl 2-(5-chloro-2-oxobenzo[d]oxazol-3(2H)-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate (CAS 29176-91-8) is a chemical compound with the molecular formula C11H10ClNO4 and a molecular weight of 255.65 g/mol. IUPAC name: ethyl 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate. InChIKey: ZSOLENFRYFPLIT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO4 |
|---|---|
| Molecular weight | 255.65 g/mol |
| IUPAC name | ethyl 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate |
| InChIKey | ZSOLENFRYFPLIT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C2=C(C=CC(=C2)Cl)OC1=O |
Computed by PubChem (NCBI)