CAS 1046757-30-5 appears in our catalog under these names: 2-Amino-n-(3,4-difluorophenyl)acetamide hydrochloride, 95%, 2-Amino-N-(3,4-difluorophenyl)acetamide hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
2-amino-N-(3,4-difluorophenyl)acetamide;hydrochloride (CAS 1046757-30-5) is a chemical compound with the molecular formula C8H9ClF2N2O and a molecular weight of 222.62 g/mol. IUPAC name: 2-amino-N-(3,4-difluorophenyl)acetamide;hydrochloride. InChIKey: UWYLGAUTOVJQSC-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF2N2O |
|---|---|
| Molecular weight | 222.62 g/mol |
| IUPAC name | 2-amino-N-(3,4-difluorophenyl)acetamide;hydrochloride |
| InChIKey | UWYLGAUTOVJQSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CN)F)F.Cl |
Computed by PubChem (NCBI)