CAS 2225147-46-4 is the registry number for 2-(2,6-Difluorophenyl)acetohydrazide hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(2,6-difluorophenyl)acetohydrazide;hydrochloride (CAS 2225147-46-4) is a chemical compound with the molecular formula C8H9ClF2N2O and a molecular weight of 222.62 g/mol. IUPAC name: 2-(2,6-difluorophenyl)acetohydrazide;hydrochloride. InChIKey: DGKDTBIJINGLQV-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF2N2O |
|---|---|
| Molecular weight | 222.62 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)acetohydrazide;hydrochloride |
| InChIKey | DGKDTBIJINGLQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CC(=O)NN)F.Cl |
Computed by PubChem (NCBI)