CAS 1046757-37-2 is the registry number for N1-(2,5-Difluorophenyl)glycinamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-amino-N-(2,5-difluorophenyl)acetamide;hydrochloride (CAS 1046757-37-2) is a chemical compound with the molecular formula C8H9ClF2N2O and a molecular weight of 222.62 g/mol. IUPAC name: 2-amino-N-(2,5-difluorophenyl)acetamide;hydrochloride. InChIKey: MFICBTPGWRETDY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF2N2O |
|---|---|
| Molecular weight | 222.62 g/mol |
| IUPAC name | 2-amino-N-(2,5-difluorophenyl)acetamide;hydrochloride |
| InChIKey | MFICBTPGWRETDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)NC(=O)CN)F.Cl |
Computed by PubChem (NCBI)