CAS 1047-63-8 is the registry number for 1,4–Bis(1H–benzo(d)imidazol–2–yl)benzene. Offered by: GLPBio. Available pack sizes: 1g.
2-[4-(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole (CAS 1047-63-8) is a chemical compound with the molecular formula C20H14N4 and a molecular weight of 310.4 g/mol. IUPAC name: 2-[4-(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole. InChIKey: WHEVDDQAPKQQAV-UHFFFAOYSA-N.
| Molecular formula | C20H14N4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2-[4-(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole |
| InChIKey | WHEVDDQAPKQQAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC=C(C=C3)C4=NC5=CC=CC=C5N4 |
Computed by PubChem (NCBI)