CAS 1186302-88-4 appears in our catalog under these names: 1,1'–(1,4–Phenylene)bis(1H–benzimidazole), 1,4-Bis(1H-benzo[d]imidazol-1-yl)benzene, 95%, 95%, 1,4-Bis(1H-benzo[d]imidazol-1-yl)benzene, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
1-[4-(benzimidazol-1-yl)phenyl]benzimidazole (CAS 1186302-88-4) is a chemical compound with the molecular formula C20H14N4 and a molecular weight of 310.4 g/mol. IUPAC name: 1-[4-(benzimidazol-1-yl)phenyl]benzimidazole. InChIKey: XJKDWBBZAPRNFF-UHFFFAOYSA-N.
| Molecular formula | C20H14N4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 1-[4-(benzimidazol-1-yl)phenyl]benzimidazole |
| InChIKey | XJKDWBBZAPRNFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2C3=CC=C(C=C3)N4C=NC5=CC=CC=C54 |
Computed by PubChem (NCBI)