CAS 4506-61-0 appears in our catalog under these names: 1H-Benzimidazole, 2,2'-(1,2-phenylene)bis-, 98%, 2,2'–(1,2–Phenylene)bis(1H–benzimidazole), 2,2′-(1,2-Phenylene)bis[1H-benzimidazole], 98%, 98%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-[2-(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole (CAS 4506-61-0) is a chemical compound with the molecular formula C20H14N4 and a molecular weight of 310.4 g/mol. IUPAC name: 2-[2-(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole. InChIKey: NQVCKXMOMGRVES-UHFFFAOYSA-N.
| Molecular formula | C20H14N4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2-[2-(1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole |
| InChIKey | NQVCKXMOMGRVES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=CC=CC=C3N2)C4=NC5=CC=CC=C5N4 |
Computed by PubChem (NCBI)