Products 1047627-23-5

CAS 1047627-23-5 is the registry number for Rel-((1r,4r)-4-formylcyclohexyl)methyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4-formylcyclohexyl)methyl acetate (CAS 1047627-23-5) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: (4-formylcyclohexyl)methyl acetate. InChIKey: NIZWXLCKPIEGOH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O3
Molecular weight184.23 g/mol
IUPAC name(4-formylcyclohexyl)methyl acetate
InChIKeyNIZWXLCKPIEGOH-UHFFFAOYSA-N
SMILESCC(=O)OCC1CCC(CC1)C=O

Computed by PubChem (NCBI)