CAS 1047631-90-2 is the registry number for (1S,2S)-Rel-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Cis-(1R,2R)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid;hydrochloride (CAS 1047631-90-2) is a chemical compound with the molecular formula C5H7ClF3NO2 and a molecular weight of 205.56 g/mol. IUPAC name: cis-(1R,2R)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid;hydrochloride. InChIKey: QGKTVRJMCFQMAX-VICLGFPZSA-N.
| Molecular formula | C5H7ClF3NO2 |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | cis-(1R,2R)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid;hydrochloride |
| InChIKey | QGKTVRJMCFQMAX-VICLGFPZSA-N |
| SMILES | C1[C@H]([C@]1(C(=O)O)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)