CAS 1638765-43-1 is the registry number for 3-(Trifluoromethyl)azetidine-3-carboxylic acid hydrochloride, 98+%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 250mg.
3-(trifluoromethyl)azetidine-3-carboxylic acid;hydrochloride (CAS 1638765-43-1) is a chemical compound with the molecular formula C5H7ClF3NO2 and a molecular weight of 205.56 g/mol. IUPAC name: 3-(trifluoromethyl)azetidine-3-carboxylic acid;hydrochloride. InChIKey: QGOBTPKHNHAESV-UHFFFAOYSA-N.
| Molecular formula | C5H7ClF3NO2 |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | 3-(trifluoromethyl)azetidine-3-carboxylic acid;hydrochloride |
| InChIKey | QGOBTPKHNHAESV-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C(=O)O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)