CAS 294176-83-3 is the registry number for (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropanecarboxylic acid hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Cis-(1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid;hydrochloride (CAS 294176-83-3) is a chemical compound with the molecular formula C5H7ClF3NO2 and a molecular weight of 205.56 g/mol. IUPAC name: cis-(1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid;hydrochloride. InChIKey: QGKTVRJMCFQMAX-QYEIVYHBSA-N.
| Molecular formula | C5H7ClF3NO2 |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | cis-(1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid;hydrochloride |
| InChIKey | QGKTVRJMCFQMAX-QYEIVYHBSA-N |
| SMILES | C1[C@@H]([C@@]1(C(=O)O)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)