CAS 1047721-44-7 is the registry number for Rel-(1S,2R)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 1047721-44-7) is a chemical compound with the molecular formula C5H6F3NO2 and a molecular weight of 169.10 g/mol. IUPAC name: cis-(1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: XYADPSWBCYPNKY-OKKQSCSOSA-N.
| Molecular formula | C5H6F3NO2 |
|---|---|
| Molecular weight | 169.10 g/mol |
| IUPAC name | cis-(1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | XYADPSWBCYPNKY-OKKQSCSOSA-N |
| SMILES | C1[C@@H]([C@@]1(C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)