Products 1638920-29-2

CAS 1638920-29-2 is the registry number for 3-(Trifluoromethyl)azetidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(trifluoromethyl)azetidine-3-carboxylic acid (CAS 1638920-29-2) is a chemical compound with the molecular formula C5H6F3NO2 and a molecular weight of 169.10 g/mol. IUPAC name: 3-(trifluoromethyl)azetidine-3-carboxylic acid. InChIKey: QIOJAYORNUJRGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6F3NO2
Molecular weight169.10 g/mol
IUPAC name3-(trifluoromethyl)azetidine-3-carboxylic acid
InChIKeyQIOJAYORNUJRGJ-UHFFFAOYSA-N
SMILESC1C(CN1)(C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)