CAS 1047721-45-8 is the registry number for (1S,2R)-1-Amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2R)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 1047721-45-8) is a chemical compound with the molecular formula C5H6F3NO2 and a molecular weight of 169.10 g/mol. IUPAC name: trans-(1S,2R)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: XYADPSWBCYPNKY-FONMRSAGSA-N.
| Molecular formula | C5H6F3NO2 |
|---|---|
| Molecular weight | 169.10 g/mol |
| IUPAC name | trans-(1S,2R)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | XYADPSWBCYPNKY-FONMRSAGSA-N |
| SMILES | C1[C@H]([C@@]1(C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)