Products 1047724-30-0
CAS 1047724-30-0 is the registry number for 2-((4-methylphenyl)sulfonyl)-3-(phenylamino)-3-sulfanylprop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 5000mg.
(Z)-3-anilino-2-(4-methylphenyl)sulfonyl-3-sulfanylprop-2-enenitrile (CAS 1047724-30-0) is a chemical compound with the molecular formula C16H14N2O2S2 and a molecular weight of 330.4 g/mol. IUPAC name: (Z)-3-anilino-2-(4-methylphenyl)sulfonyl-3-sulfanylprop-2-enenitrile. InChIKey: MIJSCVNDACPPNG-NXVVXOECSA-N.
| Molecular formula | C16H14N2O2S2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | (Z)-3-anilino-2-(4-methylphenyl)sulfonyl-3-sulfanylprop-2-enenitrile |
| InChIKey | MIJSCVNDACPPNG-NXVVXOECSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)/C(=C(/NC2=CC=CC=C2)\S)/C#N |
Computed by PubChem (NCBI)