CAS 1799604-87-7 is the registry number for 3-methylthio-3-(phenylamino)-2-(phenylsulfonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-3-anilino-2-(benzenesulfonyl)-3-methylsulfanylprop-2-enenitrile (CAS 1799604-87-7) is a chemical compound with the molecular formula C16H14N2O2S2 and a molecular weight of 330.4 g/mol. IUPAC name: (E)-3-anilino-2-(benzenesulfonyl)-3-methylsulfanylprop-2-enenitrile. InChIKey: YGJCIUAYCHMPBU-FOCLMDBBSA-N.
| Molecular formula | C16H14N2O2S2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | (E)-3-anilino-2-(benzenesulfonyl)-3-methylsulfanylprop-2-enenitrile |
| InChIKey | YGJCIUAYCHMPBU-FOCLMDBBSA-N |
| SMILES | CS/C(=C(\C#N)/S(=O)(=O)C1=CC=CC=C1)/NC2=CC=CC=C2 |
Computed by PubChem (NCBI)