CAS 1048326-72-2 is the registry number for [1-Allyl-1-(4-methylphenyl)-3-buten-1-yl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(4-methylphenyl)hepta-1,6-dien-4-amine;hydrochloride (CAS 1048326-72-2) is a chemical compound with the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. IUPAC name: 4-(4-methylphenyl)hepta-1,6-dien-4-amine;hydrochloride. InChIKey: ZPKUITKZVIHSPR-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN |
|---|---|
| Molecular weight | 237.77 g/mol |
| IUPAC name | 4-(4-methylphenyl)hepta-1,6-dien-4-amine;hydrochloride |
| InChIKey | ZPKUITKZVIHSPR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(CC=C)(CC=C)N.Cl |
Computed by PubChem (NCBI)