CAS 39628-11-0 appears in our catalog under these names: Camfetamine Hydrochloride, Camfetamine Hydrochloride (N-Methyl-3-phenylnorbornan-2-amine Hydrochloride), Camfetamine Hydrochloride (N-Methyl-3-phenylnorbornan-2-amine Hydrochloride) 1.0 mg/ml in Methanol (as free base), Camfetamine Hydrochloride(N-Methyl-3-phenylnorbornan-2-amine Hydrochloride). Offered by: TRC, LoGiCal, Mikromol, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 1ml, 4x25mg, 25mg, 50mg.
N-methyl-3-phenylbicyclo[2.2.1]heptan-2-amine;hydrochloride (CAS 39628-11-0) is a chemical compound with the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. IUPAC name: N-methyl-3-phenylbicyclo[2.2.1]heptan-2-amine;hydrochloride. InChIKey: SNBVPXDDYLRLIK-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN |
|---|---|
| Molecular weight | 237.77 g/mol |
| IUPAC name | N-methyl-3-phenylbicyclo[2.2.1]heptan-2-amine;hydrochloride |
| InChIKey | SNBVPXDDYLRLIK-UHFFFAOYSA-N |
| SMILES | CNC1C2CCC(C2)C1C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)