Products 1213143-78-2
CAS 1213143-78-2 is the registry number for (S)-2-(4-Chloro-3,5-diethylphenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(4-chloro-3,5-diethylphenyl)pyrrolidine (CAS 1213143-78-2) is a chemical compound with the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. IUPAC name: (2S)-2-(4-chloro-3,5-diethylphenyl)pyrrolidine. InChIKey: DRBARZXVLJQCII-ZDUSSCGKSA-N.
| Molecular formula | C14H20ClN |
|---|---|
| Molecular weight | 237.77 g/mol |
| IUPAC name | (2S)-2-(4-chloro-3,5-diethylphenyl)pyrrolidine |
| InChIKey | DRBARZXVLJQCII-ZDUSSCGKSA-N |
| SMILES | CCC1=CC(=CC(=C1Cl)CC)[C@@H]2CCCN2 |
Computed by PubChem (NCBI)