Products 1423-97-8
CAS 1423-97-8 appears in our catalog under these names: Estrone Impurity 8, 17-beta-Dihydro Equilenin, Equilenin Impurity 4, 17Beta-Dihydro Equilenin, >95% (HPLC), 17b-Dihydro Equilenin, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
(13S,14S,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene-3,17-diol (CAS 1423-97-8) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: (13S,14S,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene-3,17-diol. InChIKey: RYWZPRVUQHMJFF-BZSNNMDCSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | (13S,14S,17S)-13-methyl-11,12,14,15,16,17-hexahydrocyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | RYWZPRVUQHMJFF-BZSNNMDCSA-N |
| SMILES | C[C@]12CCC3=C([C@@H]1CC[C@@H]2O)C=CC4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)