CAS 343272-52-6 appears in our catalog under these names: 3-(6-Methoxynaphthalen-2-yl)-5-methylcyclohexanone, Nebumetone Impurity A, Nabumetone Impurity 1（Nabumetone EP Impurity A）, 3-(6-Methoxy-2-naphthalenyl)-5-methylcyclohexanone (Impurity), >95% (HPLC), Nabumetone EP Impurity A. Offered by: Mikromol, Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: 4x25mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
3-(6-methoxynaphthalen-2-yl)-5-methylcyclohexan-1-one (CAS 343272-52-6) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: 3-(6-methoxynaphthalen-2-yl)-5-methylcyclohexan-1-one. InChIKey: JAQDUSAFXSHFAH-UHFFFAOYSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 3-(6-methoxynaphthalen-2-yl)-5-methylcyclohexan-1-one |
| InChIKey | JAQDUSAFXSHFAH-UHFFFAOYSA-N |
| SMILES | CC1CC(CC(=O)C1)C2=CC3=C(C=C2)C=C(C=C3)OC |
Computed by PubChem (NCBI)