CAS 104872-94-8 appears in our catalog under these names: 6-(Dihydrogen phosphate)-D-Mannopyranose Barium Salt, D-Mannose-6-phosphate barium salt hydrate. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 10mg.
Barium(2+);[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] phosphate (CAS 104872-94-8) is a chemical compound with the molecular formula C6H11BaO9P and a molecular weight of 395.45 g/mol. IUPAC name: barium(2+);[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] phosphate. InChIKey: KJWDCDDLVOHIBC-MVNLRXSJSA-L.
| Molecular formula | C6H11BaO9P |
|---|---|
| Molecular weight | 395.45 g/mol |
| IUPAC name | barium(2+);[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] phosphate |
| InChIKey | KJWDCDDLVOHIBC-MVNLRXSJSA-L |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)O)O)O)O)OP(=O)([O-])[O-].[Ba+2] |
Computed by PubChem (NCBI)