CAS 58823-95-3 appears in our catalog under these names: D-Glucose 6-phosphate barium salt heptahydrate, 98%, Barium ((2R,3S,4S,5R)–3,4,5,6–tetrahydroxytetrahydro–2H–pyran–2–yl)methyl phosphate, D-Glucose-6-phosphate barium, D-Glucose 6-Phosphate Barium Salt Heptahydrate, >98.0%(HPLC), Barium (2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl phosphate(1:x). Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 100mg, 2g, 5g, 25g, 10g.
Barium(2+);[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl phosphate (CAS 58823-95-3) is a chemical compound with the molecular formula C6H11BaO9P and a molecular weight of 395.45 g/mol. IUPAC name: barium(2+);[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl phosphate. InChIKey: FFNFQIZRCUHVAP-WYRLRVFGSA-L.
| Molecular formula | C6H11BaO9P |
|---|---|
| Molecular weight | 395.45 g/mol |
| IUPAC name | barium(2+);[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl phosphate |
| InChIKey | FFNFQIZRCUHVAP-WYRLRVFGSA-L |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O)OP(=O)([O-])[O-].[Ba+2] |
Computed by PubChem (NCBI)