Products 1048919-66-9
CAS 1048919-66-9 appears in our catalog under these names: trans–2–(4–isopropylphenyl)cyclopropane–1–carboxylic acid, 2-(4-(Propan-2-yl)phenyl)cyclopropane-1-carboxylic acid, 2-[4-(Propan-2-yl)phenyl]cyclopropane-1-carboxylic acid, 98%, 2-(4-Isopropylphenyl)cyclopropane-1-carboxylic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
2-(4-propan-2-ylphenyl)cyclopropane-1-carboxylic acid (CAS 1048919-66-9) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 2-(4-propan-2-ylphenyl)cyclopropane-1-carboxylic acid. InChIKey: NOGUBTGKXFAAGO-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 2-(4-propan-2-ylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | NOGUBTGKXFAAGO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2CC2C(=O)O |
Computed by PubChem (NCBI)