CAS 1048962-91-9 appears in our catalog under these names: Rel-methyl (3R,5S)-5-hydroxytetrahydro-2H-pyran-3-carboxylate, 95%, rac-Methyl (3R,5S)-5-hydroxyoxane-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
Methyl (3S,5R)-5-hydroxyoxane-3-carboxylate (CAS 1048962-91-9) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. IUPAC name: methyl (3S,5R)-5-hydroxyoxane-3-carboxylate. InChIKey: TVDGYINOOUKBLT-NTSWFWBYSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | methyl (3S,5R)-5-hydroxyoxane-3-carboxylate |
| InChIKey | TVDGYINOOUKBLT-NTSWFWBYSA-N |
| SMILES | COC(=O)[C@H]1C[C@H](COC1)O |
Computed by PubChem (NCBI)