CAS 1048962-94-2 is the registry number for 1,5-Anhydro-2,3-dideoxy-2-(methoxycarbonyl)-threo-pentitol. Offered by: TRC. Available pack sizes: 100mg.
Methyl (3R,5R)-5-hydroxyoxane-3-carboxylate (CAS 1048962-94-2) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. IUPAC name: methyl (3R,5R)-5-hydroxyoxane-3-carboxylate. InChIKey: TVDGYINOOUKBLT-PHDIDXHHSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | methyl (3R,5R)-5-hydroxyoxane-3-carboxylate |
| InChIKey | TVDGYINOOUKBLT-PHDIDXHHSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](COC1)O |
Computed by PubChem (NCBI)