CAS 1932327-58-6 is the registry number for Methyl (3S,5S)-5-hydroxytetrahydro-2H-pyran-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3S,5S)-5-hydroxyoxane-3-carboxylate (CAS 1932327-58-6) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. IUPAC name: methyl (3S,5S)-5-hydroxyoxane-3-carboxylate. InChIKey: TVDGYINOOUKBLT-WDSKDSINSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | methyl (3S,5S)-5-hydroxyoxane-3-carboxylate |
| InChIKey | TVDGYINOOUKBLT-WDSKDSINSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H](COC1)O |
Computed by PubChem (NCBI)