CAS 1049128-39-3 is the registry number for 5-([1,1'-Biphenyl]-4-yl)-2,4-dihydro-3H-pyrazol-3-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-phenylphenyl)-1,4-dihydropyrazol-5-one (CAS 1049128-39-3) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 3-(4-phenylphenyl)-1,4-dihydropyrazol-5-one. InChIKey: PGJQRTHXGLIPQM-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 3-(4-phenylphenyl)-1,4-dihydropyrazol-5-one |
| InChIKey | PGJQRTHXGLIPQM-UHFFFAOYSA-N |
| SMILES | C1C(=NNC1=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)