CAS 10493-43-3 is the registry number for Pentafluoroethyl Trifluorovinyl Ether. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,1,2,2-pentafluoro-2-(1,2,2-trifluoroethenoxy)ethane (CAS 10493-43-3) is a chemical compound with the molecular formula C4F8O and a molecular weight of 216.03 g/mol. IUPAC name: 1,1,1,2,2-pentafluoro-2-(1,2,2-trifluoroethenoxy)ethane. InChIKey: GWTYBAOENKSFAY-UHFFFAOYSA-N.
| Molecular formula | C4F8O |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 1,1,1,2,2-pentafluoro-2-(1,2,2-trifluoroethenoxy)ethane |
| InChIKey | GWTYBAOENKSFAY-UHFFFAOYSA-N |
| SMILES | C(=C(F)F)(OC(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)