CAS 137741-09-4 is the registry number for Perfluoro(1-methoxyprop-1-ene), 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,2,3,3,3-pentafluoro-1-(trifluoromethoxy)prop-1-ene (CAS 137741-09-4) is a chemical compound with the molecular formula C4F8O and a molecular weight of 216.03 g/mol. IUPAC name: 1,2,3,3,3-pentafluoro-1-(trifluoromethoxy)prop-1-ene. InChIKey: SYLBHDWIEFOPOP-UHFFFAOYSA-N.
| Molecular formula | C4F8O |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 1,2,3,3,3-pentafluoro-1-(trifluoromethoxy)prop-1-ene |
| InChIKey | SYLBHDWIEFOPOP-UHFFFAOYSA-N |
| SMILES | C(=C(OC(F)(F)F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)