CAS 67641-44-5 is the registry number for 1,1,2,3,3-Pentafluoro-3-(trifluoromethoxy)-1-propene. Offered by: Biosynth. Available pack sizes: 1g.
1,1,2,3,3-pentafluoro-3-(trifluoromethoxy)prop-1-ene (CAS 67641-44-5) is a chemical compound with the molecular formula C4F8O and a molecular weight of 216.03 g/mol. IUPAC name: 1,1,2,3,3-pentafluoro-3-(trifluoromethoxy)prop-1-ene. InChIKey: QPYXRHPMKLWCEA-UHFFFAOYSA-N.
| Molecular formula | C4F8O |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 1,1,2,3,3-pentafluoro-3-(trifluoromethoxy)prop-1-ene |
| InChIKey | QPYXRHPMKLWCEA-UHFFFAOYSA-N |
| SMILES | C(=C(F)F)(C(OC(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)