CAS 1049716-97-3 appears in our catalog under these names: 2-Hydroxymethyl-1H-benzoimidazole-5-carboxylic acid hydrochloride, 2-Hydroxymethyl-1H-benzoimidazole-5-carboxylic acid, hydrochloride, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 10g.
2-(hydroxymethyl)-3H-benzimidazole-5-carboxylic acid;hydrochloride (CAS 1049716-97-3) is a chemical compound with the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. IUPAC name: 2-(hydroxymethyl)-3H-benzimidazole-5-carboxylic acid;hydrochloride. InChIKey: RYJIVFLZDLNRMU-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 2-(hydroxymethyl)-3H-benzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | RYJIVFLZDLNRMU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=N2)CO.Cl |
Computed by PubChem (NCBI)