CAS 1049727-56-1 is the registry number for (3S,4R)-4-(4-Fluorophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.
(3S,4R)-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1049727-56-1) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: (3S,4R)-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: ABOVCUXVEBGHCL-BAUSSPIASA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | (3S,4R)-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | ABOVCUXVEBGHCL-BAUSSPIASA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(=O)O)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)