Products 1049734-95-3
CAS 1049734-95-3 is the registry number for (+/-)-Trans-4-(3-cyanophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg.
(3R,4S)-4-(3-cyanophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1049734-95-3) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: (3R,4S)-4-(3-cyanophenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: HJABUIHPPBREPS-DHXVBOOMSA-N.
| Molecular formula | C12H13ClN2O2 |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | (3R,4S)-4-(3-cyanophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | HJABUIHPPBREPS-DHXVBOOMSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC=CC(=C2)C#N.Cl |
Computed by PubChem (NCBI)