Products 893722-06-0
CAS 893722-06-0 appears in our catalog under these names: N-(1-Acetyl-2,3-dihydro-1h-indol-5-yl)-2-chloroacetamide, 95%, N-(1-Acetyl-2,3-dihydro-1H-indol-5-yl)-2-chloroacetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
N-(1-acetyl-2,3-dihydroindol-5-yl)-2-chloroacetamide (CAS 893722-06-0) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: N-(1-acetyl-2,3-dihydroindol-5-yl)-2-chloroacetamide. InChIKey: BWBNSUNJJXLBSE-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O2 |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | N-(1-acetyl-2,3-dihydroindol-5-yl)-2-chloroacetamide |
| InChIKey | BWBNSUNJJXLBSE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=CC(=C2)NC(=O)CCl |
Computed by PubChem (NCBI)