CAS 92926-63-1 appears in our catalog under these names: 6-Chloro-1,2-dihydro-2-oxospiro[4h-3,1-benzoxazin-4,4'-piperidine], 95%, 6-Chloro-1,2-dihydro-2-oxospiro[4H-3,1-benzoxazin-4,4'-piperidine], 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 50mg.
6-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one (CAS 92926-63-1) is a chemical compound with the molecular formula C12H13ClN2O2 and a molecular weight of 252.69 g/mol. IUPAC name: 6-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one. InChIKey: YVMBDVRYWIKNEA-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O2 |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | 6-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one |
| InChIKey | YVMBDVRYWIKNEA-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=CC(=C3)Cl)NC(=O)O2 |
Computed by PubChem (NCBI)