CAS 1049737-86-1 is the registry number for 2-(4,6-Dichloro-1H-indol-3-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4,6-dichloro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1049737-86-1) is a chemical compound with the molecular formula C10H11Cl3N2 and a molecular weight of 265.6 g/mol. IUPAC name: 2-(4,6-dichloro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: MBCCWOBPGPMGRY-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl3N2 |
|---|---|
| Molecular weight | 265.6 g/mol |
| IUPAC name | 2-(4,6-dichloro-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | MBCCWOBPGPMGRY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC=C2CCN)Cl)Cl.Cl |
Computed by PubChem (NCBI)