CAS 94850-28-9 is the registry number for 5,7–dichloro Tryptamine (hydrochloride). Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 25mg, 5mg.
2-(5,7-dichloro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 94850-28-9) is a chemical compound with the molecular formula C10H11Cl3N2 and a molecular weight of 265.6 g/mol. IUPAC name: 2-(5,7-dichloro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: XSDPVTXXLWEISX-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl3N2 |
|---|---|
| Molecular weight | 265.6 g/mol |
| IUPAC name | 2-(5,7-dichloro-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | XSDPVTXXLWEISX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CN2)CCN)Cl)Cl.Cl |
Computed by PubChem (NCBI)