CAS 1803600-78-3 is the registry number for 5-Chloronaphthalene-1,4-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-chloronaphthalene-1,4-diamine;dihydrochloride (CAS 1803600-78-3) is a chemical compound with the molecular formula C10H11Cl3N2 and a molecular weight of 265.6 g/mol. IUPAC name: 5-chloronaphthalene-1,4-diamine;dihydrochloride. InChIKey: GFRAHSKGOBWLHL-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl3N2 |
|---|---|
| Molecular weight | 265.6 g/mol |
| IUPAC name | 5-chloronaphthalene-1,4-diamine;dihydrochloride |
| InChIKey | GFRAHSKGOBWLHL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C(=C1)Cl)N)N.Cl.Cl |
Computed by PubChem (NCBI)