CAS 1049744-22-0 is the registry number for (2S,4R)-4-(2-Iodobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S,4R)-4-[(2-iodophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049744-22-0) is a chemical compound with the molecular formula C12H15ClINO2 and a molecular weight of 367.61 g/mol. IUPAC name: (2S,4R)-4-[(2-iodophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: MCQOLORVFBWETG-NINOIYOQSA-N.
| Molecular formula | C12H15ClINO2 |
|---|---|
| Molecular weight | 367.61 g/mol |
| IUPAC name | (2S,4R)-4-[(2-iodophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | MCQOLORVFBWETG-NINOIYOQSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC=CC=C2I.Cl |
Computed by PubChem (NCBI)