Products 2898740-47-9
CAS 2898740-47-9 appears in our catalog under these names: 2C–I–FLY (hydrochloride), 2C-I-FLY (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
2-(4-iodo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)ethanamine;hydrochloride (CAS 2898740-47-9) is a chemical compound with the molecular formula C12H15ClINO2 and a molecular weight of 367.61 g/mol. IUPAC name: 2-(4-iodo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)ethanamine;hydrochloride. InChIKey: YHPJBLCGYJAQIV-UHFFFAOYSA-N.
| Molecular formula | C12H15ClINO2 |
|---|---|
| Molecular weight | 367.61 g/mol |
| IUPAC name | 2-(4-iodo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)ethanamine;hydrochloride |
| InChIKey | YHPJBLCGYJAQIV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C3=C(C(=C21)CCN)OCC3)I.Cl |
Computed by PubChem (NCBI)
Synonyms:
2C-I-FLY (hydrochloride), orb2945970