Products 1909318-94-0
CAS 1909318-94-0 is the registry number for 5-Iodo-2-(piperidin-1-yl)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-iodo-2-piperidin-1-ylbenzoic acid;hydrochloride (CAS 1909318-94-0) is a chemical compound with the molecular formula C12H15ClINO2 and a molecular weight of 367.61 g/mol. IUPAC name: 5-iodo-2-piperidin-1-ylbenzoic acid;hydrochloride. InChIKey: OVBAUSFMWSGYCU-UHFFFAOYSA-N.
| Molecular formula | C12H15ClINO2 |
|---|---|
| Molecular weight | 367.61 g/mol |
| IUPAC name | 5-iodo-2-piperidin-1-ylbenzoic acid;hydrochloride |
| InChIKey | OVBAUSFMWSGYCU-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)I)C(=O)O.Cl |
Computed by PubChem (NCBI)