CAS 1049745-26-7 appears in our catalog under these names: (R)-Gamma-(4-biphenyl-methyl)-L-proline hydrochloride, 95%, (2S,4R)-4-((1,1'-Biphenyl)-4-ylmethyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%, (R)-gamma-(4-Biphenylmethyl)-L-proline·HCl. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,05g, 0,1g, 0,25g, 0,5g.
(2S,4R)-4-[(4-phenylphenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049745-26-7) is a chemical compound with the molecular formula C18H20ClNO2 and a molecular weight of 317.8 g/mol. IUPAC name: (2S,4R)-4-[(4-phenylphenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: SHDWZGVXHRYAOT-CVLQQERVSA-N.
| Molecular formula | C18H20ClNO2 |
|---|---|
| Molecular weight | 317.8 g/mol |
| IUPAC name | (2S,4R)-4-[(4-phenylphenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | SHDWZGVXHRYAOT-CVLQQERVSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC=C(C=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)