Products 2940964-08-7
CAS 2940964-08-7 is the registry number for methyl 2-chloro-5-[(4-isopropylphenyl)methylamino]benzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 2-chloro-5-[(4-propan-2-ylphenyl)methylamino]benzoate (CAS 2940964-08-7) is a chemical compound with the molecular formula C18H20ClNO2 and a molecular weight of 317.8 g/mol. IUPAC name: methyl 2-chloro-5-[(4-propan-2-ylphenyl)methylamino]benzoate. InChIKey: NYNCRSMARRZCLR-UHFFFAOYSA-N.
| Molecular formula | C18H20ClNO2 |
|---|---|
| Molecular weight | 317.8 g/mol |
| IUPAC name | methyl 2-chloro-5-[(4-propan-2-ylphenyl)methylamino]benzoate |
| InChIKey | NYNCRSMARRZCLR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CNC2=CC(=C(C=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)