Products 2375267-56-2

CAS 2375267-56-2 is the registry number for 2-(1-(Diphenylmethyl)azetidin-3-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(1-benzhydrylazetidin-3-yl)acetic acid;hydrochloride (CAS 2375267-56-2) is a chemical compound with the molecular formula C18H20ClNO2 and a molecular weight of 317.8 g/mol. IUPAC name: 2-(1-benzhydrylazetidin-3-yl)acetic acid;hydrochloride. InChIKey: ZOKDAJHCZIGGOU-UHFFFAOYSA-N.

Identity
Molecular formulaC18H20ClNO2
Molecular weight317.8 g/mol
IUPAC name2-(1-benzhydrylazetidin-3-yl)acetic acid;hydrochloride
InChIKeyZOKDAJHCZIGGOU-UHFFFAOYSA-N
SMILESC1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)CC(=O)O.Cl

Computed by PubChem (NCBI)