CAS 1049745-82-5 is the registry number for 2-(3-Fluorophenyl)-2-oxoacetaldehyde hydrate 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 25g.
2-(3-fluorophenyl)-2-oxoacetaldehyde;hydrate (CAS 1049745-82-5) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: 2-(3-fluorophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: VGFHAWFFIQFSRR-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | VGFHAWFFIQFSRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)C=O.O |
Computed by PubChem (NCBI)