Products 1049750-94-8
CAS 1049750-94-8 appears in our catalog under these names: 1-(2,5-Dimethylphenyl)-3-methyl-1h-pyrazol-5-amine hydrochloride, 95%, 1-(2,5-Dimethylphenyl)-3-methyl-1H-pyrazol-5-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-(2,5-dimethylphenyl)-5-methylpyrazol-3-amine;hydrochloride (CAS 1049750-94-8) is a chemical compound with the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)-5-methylpyrazol-3-amine;hydrochloride. InChIKey: JMFARHZEJRACPS-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3 |
|---|---|
| Molecular weight | 237.73 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)-5-methylpyrazol-3-amine;hydrochloride |
| InChIKey | JMFARHZEJRACPS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)N2C(=CC(=N2)C)N.Cl |
Computed by PubChem (NCBI)