CAS 20737-84-2 is the registry number for 1-Benzyl-3,5-dimethyl-1h-pyrazol-4-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-benzyl-3,5-dimethylpyrazol-4-amine;hydrochloride (CAS 20737-84-2) is a chemical compound with the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. IUPAC name: 1-benzyl-3,5-dimethylpyrazol-4-amine;hydrochloride. InChIKey: XRFWOWWNONAYDQ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3 |
|---|---|
| Molecular weight | 237.73 g/mol |
| IUPAC name | 1-benzyl-3,5-dimethylpyrazol-4-amine;hydrochloride |
| InChIKey | XRFWOWWNONAYDQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=CC=C2)C)N.Cl |
Computed by PubChem (NCBI)