CAS 1185397-76-5 is the registry number for 4-Methyl-2-(2-pyrrolidinyl)-1h-benzimidazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-methyl-2-pyrrolidin-2-yl-1H-benzimidazole;hydrochloride (CAS 1185397-76-5) is a chemical compound with the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. IUPAC name: 4-methyl-2-pyrrolidin-2-yl-1H-benzimidazole;hydrochloride. InChIKey: LDWIVAPXQXSYFT-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3 |
|---|---|
| Molecular weight | 237.73 g/mol |
| IUPAC name | 4-methyl-2-pyrrolidin-2-yl-1H-benzimidazole;hydrochloride |
| InChIKey | LDWIVAPXQXSYFT-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)NC(=N2)C3CCCN3.Cl |
Computed by PubChem (NCBI)