Products 1049756-92-4
CAS 1049756-92-4 appears in our catalog under these names: N-mesityl-2-(methylamino)acetamide hydrochloride, 95%, 95%, N-Mesityl-2-(methylamino)acetamide hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
2-(methylamino)-N-(2,4,6-trimethylphenyl)acetamide;hydrochloride (CAS 1049756-92-4) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: 2-(methylamino)-N-(2,4,6-trimethylphenyl)acetamide;hydrochloride. InChIKey: FJUZJBFLAKYJEC-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | 2-(methylamino)-N-(2,4,6-trimethylphenyl)acetamide;hydrochloride |
| InChIKey | FJUZJBFLAKYJEC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)CNC)C.Cl |
Computed by PubChem (NCBI)